![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1519856403193.jpg | 2022-07-01 10:33 | 1.3K | |
| About Us.html | 2025-07-30 14:36 | 37K | |
| Baldwin-J.jpg | 2022-06-17 10:20 | 78K | |
| Baldwin_FHC Update.pdf | 2021-12-10 12:36 | 12M | |
| Baldwin_FHC Update_F..> | 2023-08-14 12:53 | 3.3M | |
| Blazier_Auburn Brown..> | 2023-08-14 12:53 | 22M | |
| Brown Spot Infection..> | 2022-06-21 13:32 | 33M | |
| Budget.pdf | 2021-12-10 13:37 | 327K | |
| Cloud_Brown Spot Nee..> | 2023-08-14 12:53 | 5.1M | |
| Datta_Forth Presenta..> | 2021-12-10 12:36 | 2.7M | |
| Datta_Second Present..> | 2021-12-15 08:08 | 4.3M | |
| Datta_Third Presenta..> | 2021-12-10 12:36 | 2.9M | |
| Eckhardt_Component 1..> | 2023-08-14 12:53 | 44M | |
| Eckhardt_Component 2..> | 2023-08-14 12:53 | 14M | |
| Eckhardt_Pine Declin..> | 2021-12-10 12:36 | 1.3M | |
| Eckhardt_Project Ove..> | 2023-08-14 12:54 | 17M | |
| FHC PDF to upload/ | 2020-01-22 09:34 | - | |
| Fan8-2-2023BSNB-work..> | 2023-08-14 12:54 | 4.2M | |
| Folorunso_FDHL semin..> | 2023-08-14 12:54 | 171M | |
| Forest Health Cooper..> | 2017-05-19 14:25 | 2.4K | |
| GMT20220726-182626_R..> | 2022-09-22 09:45 | 662M | |
| Golden_Co-op presi 5..> | 2023-08-14 12:54 | 7.9M | |
| Graduate Study in Re..> | 2022-08-01 09:30 | 66K | |
| Howard_BSNB meeting...> | 2023-08-14 12:54 | 6.8M | |
| Income Structure FY2..> | 2021-12-10 12:44 | 103K | |
| King_BSNB meeting Au..> | 2023-08-14 12:54 | 21M | |
| LocalShare/ | 2022-06-02 08:52 | - | |
| Log.txt | 2023-11-09 13:48 | 29K | |
| Lyons_Brown Spot Inf..> | 2023-08-14 12:54 | 1.6M | |
| MeetingFY24/ | 2023-09-05 16:13 | - | |
| MeetingMinutes_FY202..> | 2021-12-10 12:36 | 101K | |
| MeetingMinutes_FY202..> | 2021-12-10 13:44 | 101K | |
| Meet the Staff.html | 2025-07-30 14:38 | 5.1K | |
| Meet the Staff_old.html | 2022-06-17 10:08 | 6.4K | |
| MembersOnly/ | 2025-10-08 13:39 | - | |
| Menanyih_ Coop meeti..> | 2021-12-10 12:36 | 2.8M | |
| NYARKO_BSNB Presenta..> | 2023-08-14 12:54 | 8.1M | |
| Narine_BSNB_082023.pptx | 2023-08-14 12:54 | 5.3M | |
| NeedleBlightHomePage..> | 2025-11-11 13:48 | 4.4K | |
| Needle Sampling Prot..> | 2023-07-31 08:30 | 203K | |
| New Sapwood Challeng..> | 2021-12-10 13:37 | 880K | |
| Olatinwo_AuburnBSNBW..> | 2023-08-14 12:54 | 13M | |
| Olatinwo_AuburnBSNBW..> | 2023-08-14 12:54 | 14M | |
| PDF/ | 2025-11-17 10:47 | - | |
| PDF files/ | 2025-11-17 10:47 | - | |
| PINCHOT1.html | 2017-12-15 15:01 | 101K | |
| PINCHOT2.html | 2017-12-15 15:01 | 100K | |
| Pages/ | 2025-11-11 13:48 | - | |
| Photos/ | 2023-01-12 09:38 | - | |
| PhotosNeedleBlightCoop/ | 2023-08-21 16:12 | - | |
| Pictures/ | 2025-11-11 13:48 | - | |
| Pine Needle Submissi..> | 2025-11-11 14:59 | 4.7K | |
| Pine Root Submission..> | 2025-11-11 15:01 | 4.7K | |
| PowerPoint files/ | 2025-11-17 10:47 | - | |
| RR2020-02.pdf | 2021-12-15 15:09 | 443K | |
| RR2020-04.pdf | 2021-12-15 15:09 | 283K | |
| Rivera_BSNB_Workshop..> | 2023-08-14 12:54 | 41M | |
| Root Sample Collecti..> | 2023-07-31 08:36 | 206K | |
| Root Sample Collecti..> | 2023-07-31 08:30 | 97K | |
| SentinelGarden.html | 2024-11-06 12:47 | 5.7K | |
| Silva_BSNB_talk.pptx | 2023-08-14 12:54 | 34M | |
| Singh_BSNB presentat..> | 2023-08-14 12:54 | 184M | |
| TemplatePages/ | 2025-11-17 10:47 | - | |
| Templates/ | 2016-02-02 15:57 | - | |
| TemporaryFiles/ | 2025-11-17 10:47 | - | |
| Tree_Disease_Diagnos..> | 2021-12-10 13:37 | 124K | |
| Willoughby_BSNB work..> | 2023-08-14 12:54 | 10M | |
| _assets/ | 2016-02-02 15:54 | - | |
| _includes/ | 2016-02-02 15:55 | - | |
| bootstrap-4.4.1.css | 2025-11-11 13:48 | 203K | |
| css/ | 2025-11-11 13:40 | - | |
| current graduate stu..> | 2023-08-22 08:12 | 7.4K | |
| default.htm | 2022-11-21 10:37 | 7.8K | |
| default_trb.htm | 2022-11-21 10:37 | 7.5K | |
| desktop.ini | 2000-02-25 11:03 | 109 | |
| education.html | 2023-01-12 09:37 | 4.7K | |
| extensionforestry.html | 2022-06-17 10:08 | 5.4K | |
| extensionforestry_ol..> | 2022-06-17 10:08 | 5.5K | |
| forestdiseases.html | 2025-07-31 16:05 | 7.5K | |
| forestentwebsites.html | 2025-07-31 14:00 | 9.2K | |
| forestinsectpests.html | 2025-07-31 10:41 | 9.0K | |
| forestpathwebsites.html | 2025-08-01 10:40 | 12K | |
| former graduate stud..> | 2022-06-17 10:08 | 12K | |
| former graduate stud..> | 2022-06-17 10:08 | 11K | |
| grad_students_curren..> | 2025-11-11 14:29 | 5.7K | |
| grad_students_gradua..> | 2022-06-17 10:08 | 2.8K | |
| homepage_public.htm | 2025-05-29 13:36 | 8.0K | |
| images/ | 2025-11-11 13:40 | - | |
| includes/ | 2014-04-24 11:31 | - | |
| invasiveplants.html | 2025-08-01 13:35 | 4.7K | |
| job.html | 2022-11-21 10:37 | 3.4K | |
| jobs.html | 2025-11-11 14:29 | 3.3K | |
| journal articles - C..> | 2022-06-17 10:08 | 14K | |
| journal articles.html | 2022-06-17 10:08 | 14K | |
| js/ | 2025-11-11 13:40 | - | |
| manuscripts-old.html | 2022-06-17 10:08 | 7.9K | |
| manuscripts.html | 2022-06-17 10:08 | 9.0K | |
| meetings.html | 2025-11-11 14:29 | 14K | |
| meetings_nonmem.html | 2022-06-17 10:08 | 3.6K | |
| meetthestaff.jpg | 2016-06-24 14:54 | 74K | |
| non-coop_pubs.html | 2025-08-01 13:45 | 6.4K | |
| presentations.html | 2021-12-16 14:15 | 128 | |
| publications.html | 2022-06-17 10:08 | 3.6K | |
| relatedlinks.html | 2022-06-17 10:08 | 2.6K | |
| reprints.html | 2022-06-17 10:08 | 2.6K | |
| testingservices.html | 2025-08-01 13:53 | 5.2K | |